C23H26N2O4 — CID 39908237
benzyl 2-[[3-(cyclohexanecarbonylamino)benzoyl]amino]acetate (PubChem CID 39908237) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is benzyl 2-[[3-(cyclohexanecarbonylamino)benzoyl]amino]acetate.
| Compound Name | benzyl 2-[[3-(cyclohexanecarbonylamino)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 39908237 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | benzyl 2-[[3-(cyclohexanecarbonylamino)benzoyl]amino]acetate |
| SMILES | O=C(CNC(=O)c1cccc(NC(=O)C2CCCCC2)c1)OCc1ccccc1 |
| InChI | InChI=1S/C23H26N2O4/c26-21(29-16-17-8-3-1-4-9-17)15-24-22(27)19-12-7-13-20(14-19)25-23(28)18-10-5-2-6-11-18/h1,3-4,7-9,12-14,18H,2,5-6,10-11,15-16H2,(H,24,27)(H,25,28) |
| InChIKey | OUNSGXQVGMYDCW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |