C17H18N2O5S — CID 30581707
benzyl 2-[[3-(methanesulfonamido)benzoyl]amino]acetate (PubChem CID 30581707) has the molecular formula C17H18N2O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is benzyl 2-[[3-(methanesulfonamido)benzoyl]amino]acetate.
| Compound Name | benzyl 2-[[3-(methanesulfonamido)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 30581707 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | benzyl 2-[[3-(methanesulfonamido)benzoyl]amino]acetate |
| SMILES | CS(=O)(=O)Nc1cccc(C(=O)NCC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C17H18N2O5S/c1-25(22,23)19-15-9-5-8-14(10-15)17(21)18-11-16(20)24-12-13-6-3-2-4-7-13/h2-10,19H,11-12H2,1H3,(H,18,21) |
| InChIKey | FDWYJFNXQJPTAF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |