C17H15BrN2O4 — CID 55634531
(3-carbamoylphenyl)methyl 2-[(3-bromobenzoyl)amino]acetate (PubChem CID 55634531) has the molecular formula C17H15BrN2O4 and a molecular weight of 391.22 g/mol. Its IUPAC name is (3-carbamoylphenyl)methyl 2-[(3-bromobenzoyl)amino]acetate.
| Compound Name | (3-carbamoylphenyl)methyl 2-[(3-bromobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55634531 |
| Molecular Formula | C17H15BrN2O4 |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | (3-carbamoylphenyl)methyl 2-[(3-bromobenzoyl)amino]acetate |
| SMILES | NC(=O)c1cccc(COC(=O)CNC(=O)c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C17H15BrN2O4/c18-14-6-2-5-13(8-14)17(23)20-9-15(21)24-10-11-3-1-4-12(7-11)16(19)22/h1-8H,9-10H2,(H2,19,22)(H,20,23) |
| InChIKey | ZTSJPHTUYISBEL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |