C16H13BrN2O6 — CID 24557824
[2-(furan-2-carbonylamino)-2-oxoethyl] 2-[(3-bromobenzoyl)amino]acetate (PubChem CID 24557824) has the molecular formula C16H13BrN2O6 and a molecular weight of 409.19 g/mol. Its IUPAC name is [2-(furan-2-carbonylamino)-2-oxoethyl] 2-[(3-bromobenzoyl)amino]acetate.
| Compound Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 2-[(3-bromobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 24557824 |
| Molecular Formula | C16H13BrN2O6 |
| Molecular Weight | 409.19 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 2-[(3-bromobenzoyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1cccc(Br)c1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C16H13BrN2O6/c17-11-4-1-3-10(7-11)15(22)18-8-14(21)25-9-13(20)19-16(23)12-5-2-6-24-12/h1-7H,8-9H2,(H,18,22)(H,19,20,23) |
| InChIKey | JWELKHHJNLLKBF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |