C15H13FN2O5 — CID 7880328
[2-(2-fluoroanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate (PubChem CID 7880328) has the molecular formula C15H13FN2O5 and a molecular weight of 320.28 g/mol. Its IUPAC name is [2-(2-fluoroanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate.
| Compound Name | [2-(2-fluoroanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 7880328 |
| Molecular Formula | C15H13FN2O5 |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [2-(2-fluoroanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccco1)Nc1ccccc1F |
| InChI | InChI=1S/C15H13FN2O5/c16-10-4-1-2-5-11(10)18-13(19)9-23-14(20)8-17-15(21)12-6-3-7-22-12/h1-7H,8-9H2,(H,17,21)(H,18,19) |
| InChIKey | AZYCNLLXLGIIHM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |