C16H13F3N2O5 — CID 2427987
[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-(furan-2-carbonylamino)acetate (PubChem CID 2427987) has the molecular formula C16H13F3N2O5 and a molecular weight of 370.28 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-(furan-2-carbonylamino)acetate.
| Compound Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-(furan-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 2427987 |
| Molecular Formula | C16H13F3N2O5 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-(furan-2-carbonylamino)acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccco1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13F3N2O5/c17-16(18,19)10-3-5-11(6-4-10)21-13(22)9-26-14(23)8-20-15(24)12-2-1-7-25-12/h1-7H,8-9H2,(H,20,24)(H,21,22) |
| InChIKey | XFJBJFPIRRRLKZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |