C20H15F3N2O4 — CID 55776313
N-[4-[[2-[4-(trifluoromethyl)phenoxy]acetyl]amino]phenyl]furan-2-carboxamide (PubChem CID 55776313) has the molecular formula C20H15F3N2O4 and a molecular weight of 404.34 g/mol. Its IUPAC name is N-[4-[[2-[4-(trifluoromethyl)phenoxy]acetyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[2-[4-(trifluoromethyl)phenoxy]acetyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55776313 |
| Molecular Formula | C20H15F3N2O4 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-[4-[[2-[4-(trifluoromethyl)phenoxy]acetyl]amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(COc1ccc(C(F)(F)F)cc1)Nc1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C20H15F3N2O4/c21-20(22,23)13-3-9-16(10-4-13)29-12-18(26)24-14-5-7-15(8-6-14)25-19(27)17-2-1-11-28-17/h1-11H,12H2,(H,24,26)(H,25,27) |
| InChIKey | JNBCGXCNFWWLRG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |