C14H13NO5 — CID 892442
methyl 2-[4-(furan-2-carbonylamino)phenoxy]acetate (PubChem CID 892442) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is methyl 2-[4-(furan-2-carbonylamino)phenoxy]acetate.
| Compound Name | methyl 2-[4-(furan-2-carbonylamino)phenoxy]acetate |
|---|---|
| PubChem CID | 892442 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | methyl 2-[4-(furan-2-carbonylamino)phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C14H13NO5/c1-18-13(16)9-20-11-6-4-10(5-7-11)15-14(17)12-3-2-8-19-12/h2-8H,9H2,1H3,(H,15,17) |
| InChIKey | VPZXZWAJHOWUNJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |