C20H16N2O6 — CID 17172382
2-[4-[[3-(furan-2-carbonylamino)benzoyl]amino]phenoxy]acetic acid (PubChem CID 17172382) has the molecular formula C20H16N2O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is 2-[4-[[3-(furan-2-carbonylamino)benzoyl]amino]phenoxy]acetic acid.
| Compound Name | 2-[4-[[3-(furan-2-carbonylamino)benzoyl]amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 17172382 |
| Molecular Formula | C20H16N2O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-[4-[[3-(furan-2-carbonylamino)benzoyl]amino]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(NC(=O)c2cccc(NC(=O)c3ccco3)c2)cc1 |
| InChI | InChI=1S/C20H16N2O6/c23-18(24)12-28-16-8-6-14(7-9-16)21-19(25)13-3-1-4-15(11-13)22-20(26)17-5-2-10-27-17/h1-11H,12H2,(H,21,25)(H,22,26)(H,23,24) |
| InChIKey | IOPZMBOPZJNUPE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |