C25H19N3O4 — CID 55934006
N-[3-[(2-benzamidophenyl)carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 55934006) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is N-[3-[(2-benzamidophenyl)carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[(2-benzamidophenyl)carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55934006 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-[3-[(2-benzamidophenyl)carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccccc1NC(=O)c1cccc(NC(=O)c2ccco2)c1)c1ccccc1 |
| InChI | InChI=1S/C25H19N3O4/c29-23(17-8-2-1-3-9-17)27-20-12-4-5-13-21(20)28-24(30)18-10-6-11-19(16-18)26-25(31)22-14-7-15-32-22/h1-16H,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | PNHJTIZJBYGAOT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |