C18H12Cl2N2O3 — CID 171982278
N-[2-chloro-4-[(3-chlorobenzoyl)amino]phenyl]furan-2-carboxamide (PubChem CID 171982278) has the molecular formula C18H12Cl2N2O3 and a molecular weight of 375.21 g/mol. Its IUPAC name is N-[2-chloro-4-[(3-chlorobenzoyl)amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-chloro-4-[(3-chlorobenzoyl)amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 171982278 |
| Molecular Formula | C18H12Cl2N2O3 |
| Molecular Weight | 375.21 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | N-[2-chloro-4-[(3-chlorobenzoyl)amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2ccco2)c(Cl)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H12Cl2N2O3/c19-12-4-1-3-11(9-12)17(23)21-13-6-7-15(14(20)10-13)22-18(24)16-5-2-8-25-16/h1-10H,(H,21,23)(H,22,24) |
| InChIKey | OUYQYKCAHAWDRN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.21 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |