C20H13Cl3N2O3 — CID 1348018
N-[2-chloro-4-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]furan-2-carboxamide (PubChem CID 1348018) has the molecular formula C20H13Cl3N2O3 and a molecular weight of 435.69 g/mol. Its IUPAC name is N-[2-chloro-4-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-chloro-4-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1348018 |
| Molecular Formula | C20H13Cl3N2O3 |
| Molecular Weight | 435.69 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | N-[2-chloro-4-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)Nc1ccc(NC(=O)c2ccco2)c(Cl)c1 |
| InChI | InChI=1S/C20H13Cl3N2O3/c21-13-5-3-12(15(22)10-13)4-8-19(26)24-14-6-7-17(16(23)11-14)25-20(27)18-2-1-9-28-18/h1-11H,(H,24,26)(H,25,27)/b8-4+ |
| InChIKey | ZQOVEKFVXSBBNM-XBXARRHUSA-N |
| XLogP | 6.14 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.69 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|