C15H9BrCl3NO — CID 21371931
(E)-N-(4-bromo-3-chlorophenyl)-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 21371931) has the molecular formula C15H9BrCl3NO and a molecular weight of 405.51 g/mol. Its IUPAC name is (E)-N-(4-bromo-3-chlorophenyl)-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-bromo-3-chlorophenyl)-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 21371931 |
| Molecular Formula | C15H9BrCl3NO |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 402.89 |
| IUPAC Name | (E)-N-(4-bromo-3-chlorophenyl)-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C15H9BrCl3NO/c16-12-5-4-11(8-14(12)19)20-15(21)6-2-9-1-3-10(17)7-13(9)18/h1-8H,(H,20,21)/b6-2+ |
| InChIKey | PYDJATBULPHTLD-QHHAFSJGSA-N |
| XLogP | 6.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|