C20H19Cl3N2O — CID 3449576
N-(3-chloro-4-piperidin-1-ylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 3449576) has the molecular formula C20H19Cl3N2O and a molecular weight of 409.74 g/mol. Its IUPAC name is N-(3-chloro-4-piperidin-1-ylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | N-(3-chloro-4-piperidin-1-ylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3449576 |
| Molecular Formula | C20H19Cl3N2O |
| Molecular Weight | 409.74 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | N-(3-chloro-4-piperidin-1-ylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)Nc1ccc(N2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C20H19Cl3N2O/c21-15-6-4-14(17(22)12-15)5-9-20(26)24-16-7-8-19(18(23)13-16)25-10-2-1-3-11-25/h4-9,12-13H,1-3,10-11H2,(H,24,26) |
| InChIKey | FESDUJXZYKTQRV-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.74 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|