C19H18Cl2N2O — CID 70303376
(E)-3-(2,4-dichlorophenyl)-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)prop-2-enamide (PubChem CID 70303376) has the molecular formula C19H18Cl2N2O and a molecular weight of 361.27 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 70303376 |
| Molecular Formula | C19H18Cl2N2O |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)prop-2-enamide |
| SMILES | CN1CCc2ccc(NC(=O)/C=C/c3ccc(Cl)cc3Cl)cc2C1 |
| InChI | InChI=1S/C19H18Cl2N2O/c1-23-9-8-13-3-6-17(10-15(13)12-23)22-19(24)7-4-14-2-5-16(20)11-18(14)21/h2-7,10-11H,8-9,12H2,1H3,(H,22,24)/b7-4+ |
| InChIKey | ITZHITMRBQGXTE-QPJJXVBHSA-N |
| XLogP | 4.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|