C21H18Cl2F3N3OS — CID 17115724
(E)-3-(2,4-dichlorophenyl)-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 17115724) has the molecular formula C21H18Cl2F3N3OS and a molecular weight of 488.36 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17115724 |
| Molecular Formula | C21H18Cl2F3N3OS |
| Molecular Weight | 488.36 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NC(=S)Nc1cc(C(F)(F)F)ccc1N1CCCC1 |
| InChI | InChI=1S/C21H18Cl2F3N3OS/c22-15-6-3-13(16(23)12-15)4-8-19(30)28-20(31)27-17-11-14(21(24,25)26)5-7-18(17)29-9-1-2-10-29/h3-8,11-12H,1-2,9-10H2,(H2,27,28,30,31)/b8-4+ |
| InChIKey | KRHPWVISJZKLPO-XBXARRHUSA-N |
| XLogP | 6.14 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.36 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|