C21H20BrF3N2O2 — CID 17274002
(E)-3-(5-bromo-2-methoxyphenyl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 17274002) has the molecular formula C21H20BrF3N2O2 and a molecular weight of 469.30 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-methoxyphenyl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17274002 |
| Molecular Formula | C21H20BrF3N2O2 |
| Molecular Weight | 469.30 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)Nc1cc(C(F)(F)F)ccc1N1CCCC1 |
| InChI | InChI=1S/C21H20BrF3N2O2/c1-29-19-8-6-16(22)12-14(19)4-9-20(28)26-17-13-15(21(23,24)25)5-7-18(17)27-10-2-3-11-27/h4-9,12-13H,2-3,10-11H2,1H3,(H,26,28)/b9-4+ |
| InChIKey | ITIKUFRQJMMECU-RUDMXATFSA-N |
| XLogP | 5.73 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.30 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|