C25H23F3N2O3 — CID 108804986
(E)-3-(6-methyl-4-oxochromen-3-yl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 108804986) has the molecular formula C25H23F3N2O3 and a molecular weight of 456.46 g/mol. Its IUPAC name is (E)-3-(6-methyl-4-oxochromen-3-yl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(6-methyl-4-oxochromen-3-yl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108804986 |
| Molecular Formula | C25H23F3N2O3 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (E)-3-(6-methyl-4-oxochromen-3-yl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc2occ(/C=C/C(=O)Nc3cc(C(F)(F)F)ccc3N3CCCCC3)c(=O)c2c1 |
| InChI | InChI=1S/C25H23F3N2O3/c1-16-5-9-22-19(13-16)24(32)17(15-33-22)6-10-23(31)29-20-14-18(25(26,27)28)7-8-21(20)30-11-3-2-4-12-30/h5-10,13-15H,2-4,11-12H2,1H3,(H,29,31)/b10-6+ |
| InChIKey | YUTSWZSQOCGQFS-UXBLZVDNSA-N |
| XLogP | 5.76 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|