C16H19F3N2O — CID 42896639
2-methyl-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 42896639) has the molecular formula C16H19F3N2O and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-methyl-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2-methyl-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 42896639 |
| Molecular Formula | C16H19F3N2O |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-methyl-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | CC1CC1C(=O)Nc1cc(C(F)(F)F)ccc1N1CCCC1 |
| InChI | InChI=1S/C16H19F3N2O/c1-10-8-12(10)15(22)20-13-9-11(16(17,18)19)4-5-14(13)21-6-2-3-7-21/h4-5,9-10,12H,2-3,6-8H2,1H3,(H,20,22) |
| InChIKey | SMYKNLBAQOXLOX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |