C20H14F3NO3 — CID 108804960
(E)-3-(6-methyl-4-oxochromen-3-yl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 108804960) has the molecular formula C20H14F3NO3 and a molecular weight of 373.33 g/mol. Its IUPAC name is (E)-3-(6-methyl-4-oxochromen-3-yl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(6-methyl-4-oxochromen-3-yl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108804960 |
| Molecular Formula | C20H14F3NO3 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | (E)-3-(6-methyl-4-oxochromen-3-yl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc2occ(/C=C/C(=O)Nc3ccc(C(F)(F)F)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C20H14F3NO3/c1-12-2-8-17-16(10-12)19(26)13(11-27-17)3-9-18(25)24-15-6-4-14(5-7-15)20(21,22)23/h2-11H,1H3,(H,24,25)/b9-3+ |
| InChIKey | ALMBUGZXGBFAPP-YCRREMRBSA-N |
| XLogP | 4.77 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|