C17H17NO6 — CID 108793027
3-hydroxy-2-[[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]amino]butanoic acid (PubChem CID 108793027) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is 3-hydroxy-2-[[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]amino]butanoic acid.
| Compound Name | 3-hydroxy-2-[[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 108793027 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-hydroxy-2-[[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]amino]butanoic acid |
| SMILES | Cc1ccc2occ(/C=C/C(=O)NC(C(=O)O)C(C)O)c(=O)c2c1 |
| InChI | InChI=1S/C17H17NO6/c1-9-3-5-13-12(7-9)16(21)11(8-24-13)4-6-14(20)18-15(10(2)19)17(22)23/h3-8,10,15,19H,1-2H3,(H,18,20)(H,22,23)/b6-4+ |
| InChIKey | BHWYTSCVNGAZTP-GQCTYLIASA-N |
| XLogP | 1.06 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|