C20H15NO5 — CID 108792883
3-[[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]amino]benzoic acid (PubChem CID 108792883) has the molecular formula C20H15NO5 and a molecular weight of 349.34 g/mol. Its IUPAC name is 3-[[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108792883 |
| Molecular Formula | C20H15NO5 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 3-[[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]amino]benzoic acid |
| SMILES | Cc1ccc2occ(/C=C/C(=O)Nc3cccc(C(=O)O)c3)c(=O)c2c1 |
| InChI | InChI=1S/C20H15NO5/c1-12-5-7-17-16(9-12)19(23)14(11-26-17)6-8-18(22)21-15-4-2-3-13(10-15)20(24)25/h2-11H,1H3,(H,21,22)(H,24,25)/b8-6+ |
| InChIKey | FBWFPLZZQRPZGB-SOFGYWHQSA-N |
| XLogP | 3.45 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|