C23H23NO3 — CID 108804948
(E)-N-(2-butan-2-ylphenyl)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enamide (PubChem CID 108804948) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is (E)-N-(2-butan-2-ylphenyl)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-butan-2-ylphenyl)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108804948 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (E)-N-(2-butan-2-ylphenyl)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enamide |
| SMILES | CCC(C)c1ccccc1NC(=O)/C=C/c1coc2ccc(C)cc2c1=O |
| InChI | InChI=1S/C23H23NO3/c1-4-16(3)18-7-5-6-8-20(18)24-22(25)12-10-17-14-27-21-11-9-15(2)13-19(21)23(17)26/h5-14,16H,4H2,1-3H3,(H,24,25)/b12-10+ |
| InChIKey | MUHWHKDTJUDGOL-ZRDIBKRKSA-N |
| XLogP | 5.27 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|