C20H13ClF3NO3 — CID 108804988
(E)-N-[2-chloro-5-(trifluoromethyl)phenyl]-3-(6-methyl-4-oxochromen-3-yl)prop-2-enamide (PubChem CID 108804988) has the molecular formula C20H13ClF3NO3 and a molecular weight of 407.78 g/mol. Its IUPAC name is (E)-N-[2-chloro-5-(trifluoromethyl)phenyl]-3-(6-methyl-4-oxochromen-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-chloro-5-(trifluoromethyl)phenyl]-3-(6-methyl-4-oxochromen-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108804988 |
| Molecular Formula | C20H13ClF3NO3 |
| Molecular Weight | 407.78 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | (E)-N-[2-chloro-5-(trifluoromethyl)phenyl]-3-(6-methyl-4-oxochromen-3-yl)prop-2-enamide |
| SMILES | Cc1ccc2occ(/C=C/C(=O)Nc3cc(C(F)(F)F)ccc3Cl)c(=O)c2c1 |
| InChI | InChI=1S/C20H13ClF3NO3/c1-11-2-6-17-14(8-11)19(27)12(10-28-17)3-7-18(26)25-16-9-13(20(22,23)24)4-5-15(16)21/h2-10H,1H3,(H,25,26)/b7-3+ |
| InChIKey | WGHDGRTZEBYXOL-XVNBXDOJSA-N |
| XLogP | 5.43 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.78 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|