C18H17NO7 — CID 108793024
2-[[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]amino]pentanedioic acid (PubChem CID 108793024) has the molecular formula C18H17NO7 and a molecular weight of 359.33 g/mol. Its IUPAC name is 2-[[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]amino]pentanedioic acid.
| Compound Name | 2-[[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 108793024 |
| Molecular Formula | C18H17NO7 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-[[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]amino]pentanedioic acid |
| SMILES | Cc1ccc2occ(/C=C/C(=O)NC(CCC(=O)O)C(=O)O)c(=O)c2c1 |
| InChI | InChI=1S/C18H17NO7/c1-10-2-5-14-12(8-10)17(23)11(9-26-14)3-6-15(20)19-13(18(24)25)4-7-16(21)22/h2-3,5-6,8-9,13H,4,7H2,1H3,(H,19,20)(H,21,22)(H,24,25)/b6-3+ |
| InChIKey | RSLALZDEXSEYGW-ZZXKWVIFSA-N |
| XLogP | 1.55 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|