C13H12O4 — CID 16643139
3-(6-methyl-4-oxochromen-3-yl)propanoic acid (PubChem CID 16643139) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is 3-(6-methyl-4-oxochromen-3-yl)propanoic acid.
| Compound Name | 3-(6-methyl-4-oxochromen-3-yl)propanoic acid |
|---|---|
| PubChem CID | 16643139 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 3-(6-methyl-4-oxochromen-3-yl)propanoic acid |
| SMILES | Cc1ccc2occ(CCC(=O)O)c(=O)c2c1 |
| InChI | InChI=1S/C13H12O4/c1-8-2-4-11-10(6-8)13(16)9(7-17-11)3-5-12(14)15/h2,4,6-7H,3,5H2,1H3,(H,14,15) |
| InChIKey | LNNFULLADKVYCR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |