C12H9NO5 — CID 70577533
2-[(6-methyl-4-oxochromen-3-yl)amino]-2-oxoacetic acid (PubChem CID 70577533) has the molecular formula C12H9NO5 and a molecular weight of 247.21 g/mol. Its IUPAC name is 2-[(6-methyl-4-oxochromen-3-yl)amino]-2-oxoacetic acid.
| Compound Name | 2-[(6-methyl-4-oxochromen-3-yl)amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 70577533 |
| Molecular Formula | C12H9NO5 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-[(6-methyl-4-oxochromen-3-yl)amino]-2-oxoacetic acid |
| SMILES | Cc1ccc2occ(NC(=O)C(=O)O)c(=O)c2c1 |
| InChI | InChI=1S/C12H9NO5/c1-6-2-3-9-7(4-6)10(14)8(5-18-9)13-11(15)12(16)17/h2-5H,1H3,(H,13,15)(H,16,17) |
| InChIKey | NMELSRLESRVEMA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|