C26H23NO3 — CID 42785956
N-benzyl-2-methyl-N-[(6-methyl-4-oxochromen-3-yl)methyl]benzamide (PubChem CID 42785956) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is N-benzyl-2-methyl-N-[(6-methyl-4-oxochromen-3-yl)methyl]benzamide.
| Compound Name | N-benzyl-2-methyl-N-[(6-methyl-4-oxochromen-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 42785956 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-benzyl-2-methyl-N-[(6-methyl-4-oxochromen-3-yl)methyl]benzamide |
| SMILES | Cc1ccc2occ(CN(Cc3ccccc3)C(=O)c3ccccc3C)c(=O)c2c1 |
| InChI | InChI=1S/C26H23NO3/c1-18-12-13-24-23(14-18)25(28)21(17-30-24)16-27(15-20-9-4-3-5-10-20)26(29)22-11-7-6-8-19(22)2/h3-14,17H,15-16H2,1-2H3 |
| InChIKey | FQBSOHACNPGWSU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |