C29H29NO4 — CID 42785964
N-benzyl-4-butoxy-N-[(6-methyl-4-oxochromen-3-yl)methyl]benzamide (PubChem CID 42785964) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is N-benzyl-4-butoxy-N-[(6-methyl-4-oxochromen-3-yl)methyl]benzamide.
| Compound Name | N-benzyl-4-butoxy-N-[(6-methyl-4-oxochromen-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 42785964 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | N-benzyl-4-butoxy-N-[(6-methyl-4-oxochromen-3-yl)methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(Cc2ccccc2)Cc2coc3ccc(C)cc3c2=O)cc1 |
| InChI | InChI=1S/C29H29NO4/c1-3-4-16-33-25-13-11-23(12-14-25)29(32)30(18-22-8-6-5-7-9-22)19-24-20-34-27-15-10-21(2)17-26(27)28(24)31/h5-15,17,20H,3-4,16,18-19H2,1-2H3 |
| InChIKey | OEPPTMIOAVRVII-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|