C25H20ClNO3 — CID 4044640
N-benzyl-2-chloro-N-[(6-methyl-4-oxochromen-3-yl)methyl]benzamide (PubChem CID 4044640) has the molecular formula C25H20ClNO3 and a molecular weight of 417.89 g/mol. Its IUPAC name is N-benzyl-2-chloro-N-[(6-methyl-4-oxochromen-3-yl)methyl]benzamide.
| Compound Name | N-benzyl-2-chloro-N-[(6-methyl-4-oxochromen-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 4044640 |
| Molecular Formula | C25H20ClNO3 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | N-benzyl-2-chloro-N-[(6-methyl-4-oxochromen-3-yl)methyl]benzamide |
| SMILES | Cc1ccc2occ(CN(Cc3ccccc3)C(=O)c3ccccc3Cl)c(=O)c2c1 |
| InChI | InChI=1S/C25H20ClNO3/c1-17-11-12-23-21(13-17)24(28)19(16-30-23)15-27(14-18-7-3-2-4-8-18)25(29)20-9-5-6-10-22(20)26/h2-13,16H,14-15H2,1H3 |
| InChIKey | VLQPUNPTZXYPLF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |