C25H25ClN2O4 — CID 4302409
N-benzyl-2-[(2-chloroacetyl)-prop-2-enylamino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide (PubChem CID 4302409) has the molecular formula C25H25ClN2O4 and a molecular weight of 452.94 g/mol. Its IUPAC name is N-benzyl-2-[(2-chloroacetyl)-prop-2-enylamino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[(2-chloroacetyl)-prop-2-enylamino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 4302409 |
| Molecular Formula | C25H25ClN2O4 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-benzyl-2-[(2-chloroacetyl)-prop-2-enylamino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1coc2ccc(C)cc2c1=O)C(=O)CCl |
| InChI | InChI=1S/C25H25ClN2O4/c1-3-11-27(23(29)13-26)16-24(30)28(14-19-7-5-4-6-8-19)15-20-17-32-22-10-9-18(2)12-21(22)25(20)31/h3-10,12,17H,1,11,13-16H2,2H3 |
| InChIKey | BOLUOYOQQYUTGT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|