C30H29N3O4 — CID 4548119
N-benzyl-N-[(6-methyl-4-oxochromen-3-yl)methyl]-2-[phenylcarbamoyl(prop-2-enyl)amino]acetamide (PubChem CID 4548119) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-benzyl-N-[(6-methyl-4-oxochromen-3-yl)methyl]-2-[phenylcarbamoyl(prop-2-enyl)amino]acetamide.
| Compound Name | N-benzyl-N-[(6-methyl-4-oxochromen-3-yl)methyl]-2-[phenylcarbamoyl(prop-2-enyl)amino]acetamide |
|---|---|
| PubChem CID | 4548119 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | N-benzyl-N-[(6-methyl-4-oxochromen-3-yl)methyl]-2-[phenylcarbamoyl(prop-2-enyl)amino]acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1coc2ccc(C)cc2c1=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C30H29N3O4/c1-3-16-32(30(36)31-25-12-8-5-9-13-25)20-28(34)33(18-23-10-6-4-7-11-23)19-24-21-37-27-15-14-22(2)17-26(27)29(24)35/h3-15,17,21H,1,16,18-20H2,2H3,(H,31,36) |
| InChIKey | CRBONRJOFPAWSW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|