C31H29ClN2O5 — CID 5175760
N-benzyl-2-[[2-(4-chlorophenoxy)acetyl]-prop-2-enylamino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide (PubChem CID 5175760) has the molecular formula C31H29ClN2O5 and a molecular weight of 545.04 g/mol. Its IUPAC name is N-benzyl-2-[[2-(4-chlorophenoxy)acetyl]-prop-2-enylamino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[[2-(4-chlorophenoxy)acetyl]-prop-2-enylamino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 5175760 |
| Molecular Formula | C31H29ClN2O5 |
| Molecular Weight | 545.04 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | N-benzyl-2-[[2-(4-chlorophenoxy)acetyl]-prop-2-enylamino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1coc2ccc(C)cc2c1=O)C(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H29ClN2O5/c1-3-15-33(30(36)21-38-26-12-10-25(32)11-13-26)19-29(35)34(17-23-7-5-4-6-8-23)18-24-20-39-28-14-9-22(2)16-27(28)31(24)37/h3-14,16,20H,1,15,17-19,21H2,2H3 |
| InChIKey | KKCKZQWVEZCEER-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.04 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|