C22H23NO3 — CID 42785941
N-benzyl-N-[(6-methyl-4-oxochromen-3-yl)methyl]butanamide (PubChem CID 42785941) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-benzyl-N-[(6-methyl-4-oxochromen-3-yl)methyl]butanamide.
| Compound Name | N-benzyl-N-[(6-methyl-4-oxochromen-3-yl)methyl]butanamide |
|---|---|
| PubChem CID | 42785941 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-benzyl-N-[(6-methyl-4-oxochromen-3-yl)methyl]butanamide |
| SMILES | CCCC(=O)N(Cc1ccccc1)Cc1coc2ccc(C)cc2c1=O |
| InChI | InChI=1S/C22H23NO3/c1-3-7-21(24)23(13-17-8-5-4-6-9-17)14-18-15-26-20-11-10-16(2)12-19(20)22(18)25/h4-6,8-12,15H,3,7,13-14H2,1-2H3 |
| InChIKey | PMYQRLVKZLLMDU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |