C29H35ClN2O4 — CID 4180359
N-[2-[benzyl-[(6-methyl-4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-chloro-N-(3-methylbutyl)butanamide (PubChem CID 4180359) has the molecular formula C29H35ClN2O4 and a molecular weight of 511.06 g/mol. Its IUPAC name is N-[2-[benzyl-[(6-methyl-4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-chloro-N-(3-methylbutyl)butanamide.
| Compound Name | N-[2-[benzyl-[(6-methyl-4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-chloro-N-(3-methylbutyl)butanamide |
|---|---|
| PubChem CID | 4180359 |
| Molecular Formula | C29H35ClN2O4 |
| Molecular Weight | 511.06 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | N-[2-[benzyl-[(6-methyl-4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-chloro-N-(3-methylbutyl)butanamide |
| SMILES | Cc1ccc2occ(CN(Cc3ccccc3)C(=O)CN(CCC(C)C)C(=O)CCCCl)c(=O)c2c1 |
| InChI | InChI=1S/C29H35ClN2O4/c1-21(2)13-15-31(27(33)10-7-14-30)19-28(34)32(17-23-8-5-4-6-9-23)18-24-20-36-26-12-11-22(3)16-25(26)29(24)35/h4-6,8-9,11-12,16,20-21H,7,10,13-15,17-19H2,1-3H3 |
| InChIKey | WZLGGOAVDOGNEB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.06 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|