C32H33N3O6 — CID 3488960
N-benzyl-2-[(2,4-dimethoxyphenyl)carbamoyl-prop-2-enylamino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide (PubChem CID 3488960) has the molecular formula C32H33N3O6 and a molecular weight of 555.63 g/mol. Its IUPAC name is N-benzyl-2-[(2,4-dimethoxyphenyl)carbamoyl-prop-2-enylamino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[(2,4-dimethoxyphenyl)carbamoyl-prop-2-enylamino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 3488960 |
| Molecular Formula | C32H33N3O6 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | N-benzyl-2-[(2,4-dimethoxyphenyl)carbamoyl-prop-2-enylamino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1coc2ccc(C)cc2c1=O)C(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C32H33N3O6/c1-5-15-34(32(38)33-27-13-12-25(39-3)17-29(27)40-4)20-30(36)35(18-23-9-7-6-8-10-23)19-24-21-41-28-14-11-22(2)16-26(28)31(24)37/h5-14,16-17,21H,1,15,18-20H2,2-4H3,(H,33,38) |
| InChIKey | UASCGVOBTLYAET-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|