C26H21F3N2O3 — CID 4013344
1-benzyl-1-[(6-methyl-4-oxochromen-3-yl)methyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 4013344) has the molecular formula C26H21F3N2O3 and a molecular weight of 466.46 g/mol. Its IUPAC name is 1-benzyl-1-[(6-methyl-4-oxochromen-3-yl)methyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-benzyl-1-[(6-methyl-4-oxochromen-3-yl)methyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 4013344 |
| Molecular Formula | C26H21F3N2O3 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 1-benzyl-1-[(6-methyl-4-oxochromen-3-yl)methyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccc2occ(CN(Cc3ccccc3)C(=O)Nc3ccccc3C(F)(F)F)c(=O)c2c1 |
| InChI | InChI=1S/C26H21F3N2O3/c1-17-11-12-23-20(13-17)24(32)19(16-34-23)15-31(14-18-7-3-2-4-8-18)25(33)30-22-10-6-5-9-21(22)26(27,28)29/h2-13,16H,14-15H2,1H3,(H,30,33) |
| InChIKey | POCOSDJMXDYSHS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |