C21H24BrNO3 — CID 7935899
(E)-3-(5-bromo-2-methoxyphenyl)-N-(5-tert-butyl-2-methoxyphenyl)prop-2-enamide (PubChem CID 7935899) has the molecular formula C21H24BrNO3 and a molecular weight of 418.33 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-methoxyphenyl)-N-(5-tert-butyl-2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(5-tert-butyl-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7935899 |
| Molecular Formula | C21H24BrNO3 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(5-tert-butyl-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)Nc1cc(C(C)(C)C)ccc1OC |
| InChI | InChI=1S/C21H24BrNO3/c1-21(2,3)15-7-9-19(26-5)17(13-15)23-20(24)11-6-14-12-16(22)8-10-18(14)25-4/h6-13H,1-5H3,(H,23,24)/b11-6+ |
| InChIKey | OWTPEDRQUITQAK-IZZDOVSWSA-N |
| XLogP | 5.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|