C25H28F3N3OS — CID 3749215
N-[[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 3749215) has the molecular formula C25H28F3N3OS and a molecular weight of 475.58 g/mol. Its IUPAC name is N-[[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | N-[[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3749215 |
| Molecular Formula | C25H28F3N3OS |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-[[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(C)c1ccc(C=CC(=O)NC(=S)Nc2cc(C(F)(F)F)ccc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C25H28F3N3OS/c1-17(2)19-9-6-18(7-10-19)8-13-23(32)30-24(33)29-21-16-20(25(26,27)28)11-12-22(21)31-14-4-3-5-15-31/h6-13,16-17H,3-5,14-15H2,1-2H3,(H2,29,30,32,33) |
| InChIKey | CBZOLCOULJHPLR-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|