C19H17Cl2F3N2O — CID 2065695
2,4-dichloro-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 2065695) has the molecular formula C19H17Cl2F3N2O and a molecular weight of 417.26 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2065695 |
| Molecular Formula | C19H17Cl2F3N2O |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 2,4-dichloro-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1N1CCCCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl2F3N2O/c20-13-5-6-14(15(21)11-13)18(27)25-16-10-12(19(22,23)24)4-7-17(16)26-8-2-1-3-9-26/h4-7,10-11H,1-3,8-9H2,(H,25,27) |
| InChIKey | RWUSRLBSKQEAAV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |