C18H20F3N3O4S — CID 55676456
5-(methylsulfamoyl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 55676456) has the molecular formula C18H20F3N3O4S and a molecular weight of 431.44 g/mol. Its IUPAC name is 5-(methylsulfamoyl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(methylsulfamoyl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55676456 |
| Molecular Formula | C18H20F3N3O4S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 5-(methylsulfamoyl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)Nc2cc(C(F)(F)F)ccc2N2CCCCC2)o1 |
| InChI | InChI=1S/C18H20F3N3O4S/c1-22-29(26,27)16-8-7-15(28-16)17(25)23-13-11-12(18(19,20)21)5-6-14(13)24-9-3-2-4-10-24/h5-8,11,22H,2-4,9-10H2,1H3,(H,23,25) |
| InChIKey | SMSFLPDKPYWNDS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |