C17H16BrF3N2O2 — CID 1288515
5-bromo-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 1288515) has the molecular formula C17H16BrF3N2O2 and a molecular weight of 417.23 g/mol. Its IUPAC name is 5-bromo-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1288515 |
| Molecular Formula | C17H16BrF3N2O2 |
| Molecular Weight | 417.23 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 5-bromo-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1N1CCCCC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C17H16BrF3N2O2/c18-15-7-6-14(25-15)16(24)22-12-10-11(17(19,20)21)4-5-13(12)23-8-2-1-3-9-23/h4-7,10H,1-3,8-9H2,(H,22,24) |
| InChIKey | NWXJYIVIBMTGCM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.23 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |