C13H10ClF3N2O4S — CID 112521234
N-[2-chloro-5-(trifluoromethyl)phenyl]-5-(methylsulfamoyl)furan-2-carboxamide (PubChem CID 112521234) has the molecular formula C13H10ClF3N2O4S and a molecular weight of 382.75 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-5-(methylsulfamoyl)furan-2-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-5-(methylsulfamoyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 112521234 |
| Molecular Formula | C13H10ClF3N2O4S |
| Molecular Weight | 382.75 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-5-(methylsulfamoyl)furan-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)Nc2cc(C(F)(F)F)ccc2Cl)o1 |
| InChI | InChI=1S/C13H10ClF3N2O4S/c1-18-24(21,22)11-5-4-10(23-11)12(20)19-9-6-7(13(15,16)17)2-3-8(9)14/h2-6,18H,1H3,(H,19,20) |
| InChIKey | ILAUABKTWIJZBV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.75 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |