C14H10F6N2O4S — CID 38739100
N-[3,5-bis(trifluoromethyl)phenyl]-5-(methylsulfamoyl)furan-2-carboxamide (PubChem CID 38739100) has the molecular formula C14H10F6N2O4S and a molecular weight of 416.30 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-5-(methylsulfamoyl)furan-2-carboxamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-5-(methylsulfamoyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 38739100 |
| Molecular Formula | C14H10F6N2O4S |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-5-(methylsulfamoyl)furan-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C14H10F6N2O4S/c1-21-27(24,25)11-3-2-10(26-11)12(23)22-9-5-7(13(15,16)17)4-8(6-9)14(18,19)20/h2-6,21H,1H3,(H,22,23) |
| InChIKey | WHRJCXWGPVDBCZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |