C13H16N4O6S — CID 120696360
2-methyl-2-[4-[[5-(methylsulfamoyl)furan-2-carbonyl]amino]pyrazol-1-yl]propanoic acid (PubChem CID 120696360) has the molecular formula C13H16N4O6S and a molecular weight of 356.36 g/mol. Its IUPAC name is 2-methyl-2-[4-[[5-(methylsulfamoyl)furan-2-carbonyl]amino]pyrazol-1-yl]propanoic acid.
| Compound Name | 2-methyl-2-[4-[[5-(methylsulfamoyl)furan-2-carbonyl]amino]pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 120696360 |
| Molecular Formula | C13H16N4O6S |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2-methyl-2-[4-[[5-(methylsulfamoyl)furan-2-carbonyl]amino]pyrazol-1-yl]propanoic acid |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)Nc2cnn(C(C)(C)C(=O)O)c2)o1 |
| InChI | InChI=1S/C13H16N4O6S/c1-13(2,12(19)20)17-7-8(6-15-17)16-11(18)9-4-5-10(23-9)24(21,22)14-3/h4-7,14H,1-3H3,(H,16,18)(H,19,20) |
| InChIKey | HGLPMZNVHFKCJK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |