C15H18N4O5S — CID 120696781
2-methyl-2-[4-[[3-(sulfamoylmethyl)benzoyl]amino]pyrazol-1-yl]propanoic acid (PubChem CID 120696781) has the molecular formula C15H18N4O5S and a molecular weight of 366.40 g/mol. Its IUPAC name is 2-methyl-2-[4-[[3-(sulfamoylmethyl)benzoyl]amino]pyrazol-1-yl]propanoic acid.
| Compound Name | 2-methyl-2-[4-[[3-(sulfamoylmethyl)benzoyl]amino]pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 120696781 |
| Molecular Formula | C15H18N4O5S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-methyl-2-[4-[[3-(sulfamoylmethyl)benzoyl]amino]pyrazol-1-yl]propanoic acid |
| SMILES | CC(C)(C(=O)O)n1cc(NC(=O)c2cccc(CS(N)(=O)=O)c2)cn1 |
| InChI | InChI=1S/C15H18N4O5S/c1-15(2,14(21)22)19-8-12(7-17-19)18-13(20)11-5-3-4-10(6-11)9-25(16,23)24/h3-8H,9H2,1-2H3,(H,18,20)(H,21,22)(H2,16,23,24) |
| InChIKey | HXLMAFMMVPOYAN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |