C13H15N3O6S — CID 120696515
2-methyl-2-[4-[(5-methylsulfonylfuran-2-carbonyl)amino]pyrazol-1-yl]propanoic acid (PubChem CID 120696515) has the molecular formula C13H15N3O6S and a molecular weight of 341.35 g/mol. Its IUPAC name is 2-methyl-2-[4-[(5-methylsulfonylfuran-2-carbonyl)amino]pyrazol-1-yl]propanoic acid.
| Compound Name | 2-methyl-2-[4-[(5-methylsulfonylfuran-2-carbonyl)amino]pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 120696515 |
| Molecular Formula | C13H15N3O6S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 2-methyl-2-[4-[(5-methylsulfonylfuran-2-carbonyl)amino]pyrazol-1-yl]propanoic acid |
| SMILES | CC(C)(C(=O)O)n1cc(NC(=O)c2ccc(S(C)(=O)=O)o2)cn1 |
| InChI | InChI=1S/C13H15N3O6S/c1-13(2,12(18)19)16-7-8(6-14-16)15-11(17)9-4-5-10(22-9)23(3,20)21/h4-7H,1-3H3,(H,15,17)(H,18,19) |
| InChIKey | DWQCQMUVNZTCJK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |