C14H14N2O5S — CID 155412686
N-(4-acetamidophenyl)-5-methylsulfonylfuran-2-carboxamide (PubChem CID 155412686) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-5-methylsulfonylfuran-2-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-5-methylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 155412686 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-(4-acetamidophenyl)-5-methylsulfonylfuran-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2ccc(S(C)(=O)=O)o2)cc1 |
| InChI | InChI=1S/C14H14N2O5S/c1-9(17)15-10-3-5-11(6-4-10)16-14(18)12-7-8-13(21-12)22(2,19)20/h3-8H,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | XQWDLVZWOARTSW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |