C14H13BrN2O5S — CID 86944389
N-[2-(4-bromoanilino)-2-oxoethyl]-5-methylsulfonylfuran-2-carboxamide (PubChem CID 86944389) has the molecular formula C14H13BrN2O5S and a molecular weight of 401.24 g/mol. Its IUPAC name is N-[2-(4-bromoanilino)-2-oxoethyl]-5-methylsulfonylfuran-2-carboxamide.
| Compound Name | N-[2-(4-bromoanilino)-2-oxoethyl]-5-methylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 86944389 |
| Molecular Formula | C14H13BrN2O5S |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | N-[2-(4-bromoanilino)-2-oxoethyl]-5-methylsulfonylfuran-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NCC(=O)Nc2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C14H13BrN2O5S/c1-23(20,21)13-7-6-11(22-13)14(19)16-8-12(18)17-10-4-2-9(15)3-5-10/h2-7H,8H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | STWPFNWGVCEHKP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |