C7H9NO4S — CID 126970956
N-methyl-5-methylsulfonylfuran-2-carboxamide (PubChem CID 126970956) has the molecular formula C7H9NO4S and a molecular weight of 203.22 g/mol. Its IUPAC name is N-methyl-5-methylsulfonylfuran-2-carboxamide.
| Compound Name | N-methyl-5-methylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 126970956 |
| Molecular Formula | C7H9NO4S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | N-methyl-5-methylsulfonylfuran-2-carboxamide |
| SMILES | CNC(=O)c1ccc(S(C)(=O)=O)o1 |
| InChI | InChI=1S/C7H9NO4S/c1-8-7(9)5-3-4-6(12-5)13(2,10)11/h3-4H,1-2H3,(H,8,9) |
| InChIKey | SEUACFVEGHEHQN-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |